| Name | 3,5-Dimethylbenzylbromide |
| Synonyms | A-BROMOMESITYLENE TIMTEC-BB SBB008310 ALPHA-Bromomesitylene ALPHA-BROMOMESITYLENE 5-BROMOMETHYL-M-XYLENE 3,5-Dimethylbenzylbromide 3,5-Dimethylbenzyl bromide 3,5-DIMETHYLBENZYL BROMIDE 3,5-DIMETHYLBENZYL BRROMIDE 1-(bromomethyl)-3,5-dimethylbenzene 1-(Bromomethyl)-3,5-dimethylbenzene Benzene, 1-(bromomethyl)-3,5-dimethyl- |
| CAS | 27129-86-8 |
| EINECS | 212-529-6 |
| InChI | InChI=1/C9H11Br/c1-7-3-8(2)5-9(4-7)6-10/h3-5H,6H2,1-2H3 |
| Molecular Formula | C9H11Br |
| Molar Mass | 199.09 |
| Density | 1.2949 (estimate) |
| Melting Point | 37-39 °C (lit.) |
| Boling Point | 101-103 °C (8 mmHg) |
| Flash Point | 109-110°C/14mm |
| Vapor Presure | 0.0934mmHg at 25°C |
| Appearance | Solid |
| Color | Light yellow |
| BRN | 1857343 |
| Storage Condition | Inert atmosphere,2-8°C |
| Refractive Index | 1.5482 (estimate) |
| MDL | MFCD00013539 |
| Hazard Symbols | C - Corrosive![]() |
| Risk Codes | 34 - Causes burns |
| Safety Description | S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| UN IDs | 3265 |
| WGK Germany | 3 |
| HS Code | 29036990 |
| Hazard Class | 8 |
| Packing Group | III |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |